C18H24F2N4O2 — CID 123419977
3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-3-imino-N,2-dimethyl-2-(methylamino)propanamide (PubChem CID 123419977) has the molecular formula C18H24F2N4O2 and a molecular weight of 366.41 g/mol. Its IUPAC name is 3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-3-imino-N,2-dimethyl-2-(methylamino)propanamide.
| Compound Name | 3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-3-imino-N,2-dimethyl-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 123419977 |
| Molecular Formula | C18H24F2N4O2 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-3-imino-N,2-dimethyl-2-(methylamino)propanamide |
| SMILES | [H]/N=C(\c1ccc(C(=O)N2CCC(F)(F)CC2)cc1)C(C)(NC)C(=O)NC |
| InChI | InChI=1S/C18H24F2N4O2/c1-17(23-3,16(26)22-2)14(21)12-4-6-13(7-5-12)15(25)24-10-8-18(19,20)9-11-24/h4-7,21,23H,8-11H2,1-3H3,(H,22,26)/b21-14+ |
| InChIKey | IVKYLFAZEJVLHK-KGENOOAVSA-N |
| XLogP | 1.65 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|