About 4-cyano-N-ethyl-4,5-dimethylhexanamide
4-cyano-N-ethyl-4,5-dimethylhexanamide (PubChem CID 123420117) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 4-cyano-N-ethyl-4,5-dimethylhexanamide.
Molecular Properties
| Compound Name | 4-cyano-N-ethyl-4,5-dimethylhexanamide |
| PubChem CID | 123420117 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 4-cyano-N-ethyl-4,5-dimethylhexanamide |
| SMILES | CCNC(=O)CCC(C)(C#N)C(C)C |
| InChI | InChI=1S/C11H20N2O/c1-5-13-10(14)6-7-11(4,8-12)9(2)3/h9H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | YBVKLZDGKXWIOR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyano-N-ethyl-4,5-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-ethyl-4,5-dimethylhexanamide?
The IUPAC name of 4-cyano-N-ethyl-4,5-dimethylhexanamide (CID 123420117) is 4-cyano-N-ethyl-4,5-dimethylhexanamide.
What is the SMILES notation for 4-cyano-N-ethyl-4,5-dimethylhexanamide?
The canonical SMILES for 4-cyano-N-ethyl-4,5-dimethylhexanamide is CCNC(=O)CCC(C)(C#N)C(C)C.
What is the InChIKey of 4-cyano-N-ethyl-4,5-dimethylhexanamide?
The InChIKey is YBVKLZDGKXWIOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-5-13-10(14)6-7-11(4,8-12)9(2)3/h9H,5-7H2,1-4H3,(H,13,14).
What are the key properties of 4-cyano-N-ethyl-4,5-dimethylhexanamide?
4-cyano-N-ethyl-4,5-dimethylhexanamide has a molecular weight of 196.29 g/mol, XLogP of 2.09, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-ethyl-4,5-dimethylhexanamide is sourced from PubChem (CID 123420117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).