C15H21F3N2 — CID 123420437
(5E,7E)-2-ethyl-4-N-propyl-5-(trifluoromethyl)cyclonona-5,7-diene-1,4-diimine (PubChem CID 123420437) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is (5E,7E)-2-ethyl-4-N-propyl-5-(trifluoromethyl)cyclonona-5,7-diene-1,4-diimine.
| Compound Name | (5E,7E)-2-ethyl-4-N-propyl-5-(trifluoromethyl)cyclonona-5,7-diene-1,4-diimine |
|---|---|
| PubChem CID | 123420437 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (5E,7E)-2-ethyl-4-N-propyl-5-(trifluoromethyl)cyclonona-5,7-diene-1,4-diimine |
| SMILES | [H]/N=C1\C/C=C/C=C(C(F)(F)F)\C(=N\CCC)CC1CC |
| InChI | InChI=1S/C15H21F3N2/c1-3-9-20-14-10-11(4-2)13(19)8-6-5-7-12(14)15(16,17)18/h5-7,11,19H,3-4,8-10H2,1-2H3/b6-5+,12-7+,19-13+,20-14+ |
| InChIKey | AVZLUPLLEAZGMU-DEUCTRLMSA-N |
| XLogP | 4.72 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|