C20H17ClN4S — CID 1234211
(4S)-6-(4-chlorophenyl)-4-(3-methyl-1-phenylpyrazol-4-yl)-3,4-dihydro-1H-pyrimidine-2-thione (PubChem CID 1234211) has the molecular formula C20H17ClN4S and a molecular weight of 380.90 g/mol. Its IUPAC name is (4S)-6-(4-chlorophenyl)-4-(3-methyl-1-phenylpyrazol-4-yl)-3,4-dihydro-1H-pyrimidine-2-thione.
| Compound Name | (4S)-6-(4-chlorophenyl)-4-(3-methyl-1-phenylpyrazol-4-yl)-3,4-dihydro-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 1234211 |
| Molecular Formula | C20H17ClN4S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (4S)-6-(4-chlorophenyl)-4-(3-methyl-1-phenylpyrazol-4-yl)-3,4-dihydro-1H-pyrimidine-2-thione |
| SMILES | Cc1nn(-c2ccccc2)cc1[C@@H]1C=C(c2ccc(Cl)cc2)NC(=S)N1 |
| InChI | InChI=1S/C20H17ClN4S/c1-13-17(12-25(24-13)16-5-3-2-4-6-16)19-11-18(22-20(26)23-19)14-7-9-15(21)10-8-14/h2-12,19H,1H3,(H2,22,23,26)/t19-/m0/s1 |
| InChIKey | LSIDBIMWBUTLSD-IBGZPJMESA-N |
| XLogP | 4.39 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|