C11H15N3O6 — CID 123421350
5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-3-hydroxy-5-oxopentanoic acid (PubChem CID 123421350) has the molecular formula C11H15N3O6 and a molecular weight of 285.26 g/mol. Its IUPAC name is 5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-3-hydroxy-5-oxopentanoic acid.
| Compound Name | 5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-3-hydroxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123421350 |
| Molecular Formula | C11H15N3O6 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-3-hydroxy-5-oxopentanoic acid |
| SMILES | O=C(O)CC(O)CC(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C11H15N3O6/c15-7(3-10(17)18)2-9(16)14-8(11(19)20)1-6-4-12-5-13-6/h4-5,7-8,15H,1-3H2,(H,12,13)(H,14,16)(H,17,18)(H,19,20) |
| InChIKey | OAIPCSLSHVHTID-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 152.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |