C7H9FN2 — CID 123421465
5-fluoro-2,3-dimethylpyridin-4-amine (PubChem CID 123421465) has the molecular formula C7H9FN2 and a molecular weight of 140.16 g/mol. Its IUPAC name is 5-fluoro-2,3-dimethylpyridin-4-amine.
| Compound Name | 5-fluoro-2,3-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 123421465 |
| Molecular Formula | C7H9FN2 |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 5-fluoro-2,3-dimethylpyridin-4-amine |
| SMILES | Cc1ncc(F)c(N)c1C |
| InChI | InChI=1S/C7H9FN2/c1-4-5(2)10-3-6(8)7(4)9/h3H,1-2H3,(H2,9,10) |
| InChIKey | CMCSIPJPNQULAG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |