C30H23Cl2F4N7O4 — CID 123421542
2-[4-[4-[2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperazin-1-yl]pyrimidine (PubChem CID 123421542) has the molecular formula C30H23Cl2F4N7O4 and a molecular weight of 692.46 g/mol. Its IUPAC name is 2-[4-[4-[2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-[4-[2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 123421542 |
| Molecular Formula | C30H23Cl2F4N7O4 |
| Molecular Weight | 692.46 g/mol |
| Exact Mass | 691.11 |
| IUPAC Name | 2-[4-[4-[2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperazin-1-yl]pyrimidine |
| SMILES | O=[N+]([O-])c1cc(C2CCC(c3cc([N+](=O)[O-])c(Cl)cc3F)N2c2cc(F)c(N3CCN(c4ncccn4)CC3)c(F)c2)c(F)cc1Cl |
| InChI | InChI=1S/C30H23Cl2F4N7O4/c31-19-14-21(33)17(12-27(19)42(44)45)25-2-3-26(18-13-28(43(46)47)20(32)15-22(18)34)41(25)16-10-23(35)29(24(36)11-16)39-6-8-40(9-7-39)30-37-4-1-5-38-30/h1,4-5,10-15,25-26H,2-3,6-9H2 |
| InChIKey | UWVGSGRPXFETJZ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.46 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|