C21H21FN7+ — CID 123421805
1-[6-[2-amino-5-(1-methylazet-1-ium-3-yl)benzenecarboximidoyl]pyrimidin-4-yl]-4-fluoropiperidine-4-carbonitrile (PubChem CID 123421805) has the molecular formula C21H21FN7+ and a molecular weight of 390.45 g/mol. Its IUPAC name is 1-[6-[2-amino-5-(1-methylazet-1-ium-3-yl)benzenecarboximidoyl]pyrimidin-4-yl]-4-fluoropiperidine-4-carbonitrile.
| Compound Name | 1-[6-[2-amino-5-(1-methylazet-1-ium-3-yl)benzenecarboximidoyl]pyrimidin-4-yl]-4-fluoropiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 123421805 |
| Molecular Formula | C21H21FN7+ |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-[6-[2-amino-5-(1-methylazet-1-ium-3-yl)benzenecarboximidoyl]pyrimidin-4-yl]-4-fluoropiperidine-4-carbonitrile |
| SMILES | [H]/N=C(\c1cc(N2CCC(F)(C#N)CC2)ncn1)c1cc(C2=C[N+](C)=C2)ccc1N |
| InChI | InChI=1S/C21H21FN7/c1-28-10-15(11-28)14-2-3-17(24)16(8-14)20(25)18-9-19(27-13-26-18)29-6-4-21(22,12-23)5-7-29/h2-3,8-11,13,25H,4-7,24H2,1H3/q+1/b25-20- |
| InChIKey | KPBWTWRYTDTUNU-QQTULTPQSA-N |
| XLogP | 2.37 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|