About 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate
2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate (PubChem CID 123422486) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate |
| PubChem CID | 123422486 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate |
| SMILES | C=CC=C(C=C)COC(=O)NC(C)C |
| InChI | InChI=1S/C11H17NO2/c1-5-7-10(6-2)8-14-11(13)12-9(3)4/h5-7,9H,1-2,8H2,3-4H3,(H,12,13) |
| InChIKey | RMMSLLPVNSWKKA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate?
The IUPAC name of 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate (CID 123422486) is 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate.
What is the SMILES notation for 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate?
The canonical SMILES for 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate is C=CC=C(C=C)COC(=O)NC(C)C.
What is the InChIKey of 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate?
The InChIKey is RMMSLLPVNSWKKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-5-7-10(6-2)8-14-11(13)12-9(3)4/h5-7,9H,1-2,8H2,3-4H3,(H,12,13).
What are the key properties of 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate?
2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate has a molecular weight of 195.26 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylpenta-2,4-dienyl N-propan-2-ylcarbamate is sourced from PubChem (CID 123422486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).