C11H15N — CID 123423014
N-[2-(2-methylcyclohepta-1,3,6-trien-1-yl)ethyl]methanimine (PubChem CID 123423014) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is N-[2-(2-methylcyclohepta-1,3,6-trien-1-yl)ethyl]methanimine.
| Compound Name | N-[2-(2-methylcyclohepta-1,3,6-trien-1-yl)ethyl]methanimine |
|---|---|
| PubChem CID | 123423014 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | N-[2-(2-methylcyclohepta-1,3,6-trien-1-yl)ethyl]methanimine |
| SMILES | C=NCCC1=C(C)C=CCC=C1 |
| InChI | InChI=1S/C11H15N/c1-10-6-4-3-5-7-11(10)8-9-12-2/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | OQSNVHHJNHUVCP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|