C31H62N3O3+3 — CID 123423065
2-[2,3-bis[2-(triethylazaniumyl)ethoxy]cyclohepta-1,3,6-trien-1-yl]oxyethyl-triethylazanium (PubChem CID 123423065) has the molecular formula C31H62N3O3+3 and a molecular weight of 524.86 g/mol. Its IUPAC name is 2-[2,3-bis[2-(triethylazaniumyl)ethoxy]cyclohepta-1,3,6-trien-1-yl]oxyethyl-triethylazanium.
| Compound Name | 2-[2,3-bis[2-(triethylazaniumyl)ethoxy]cyclohepta-1,3,6-trien-1-yl]oxyethyl-triethylazanium |
|---|---|
| PubChem CID | 123423065 |
| Molecular Formula | C31H62N3O3+3 |
| Molecular Weight | 524.86 g/mol |
| Exact Mass | 524.48 |
| IUPAC Name | 2-[2,3-bis[2-(triethylazaniumyl)ethoxy]cyclohepta-1,3,6-trien-1-yl]oxyethyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)CCOC1=CCC=CC(OCC[N+](CC)(CC)CC)=C1OCC[N+](CC)(CC)CC |
| InChI | InChI=1S/C31H62N3O3/c1-10-32(11-2,12-3)23-26-35-29-21-19-20-22-30(36-27-24-33(13-4,14-5)15-6)31(29)37-28-25-34(16-7,17-8)18-9/h19,21-22H,10-18,20,23-28H2,1-9H3/q+3 |
| InChIKey | IKPZYSHGDOJOCA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.86 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|