About 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde
2-methyl-1,4-dihydropyrimidine-5-carbaldehyde (PubChem CID 123423409) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde |
| PubChem CID | 123423409 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde |
| SMILES | CC1=NCC(C=O)=CN1 |
| InChI | InChI=1S/C6H8N2O/c1-5-7-2-6(4-9)3-8-5/h2,4H,3H2,1H3,(H,7,8) |
| InChIKey | WYKBGLBAWNLHDV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde?
The IUPAC name of 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde (CID 123423409) is 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde.
What is the SMILES notation for 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde?
The canonical SMILES for 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde is CC1=NCC(C=O)=CN1.
What is the InChIKey of 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde?
The InChIKey is WYKBGLBAWNLHDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O/c1-5-7-2-6(4-9)3-8-5/h2,4H,3H2,1H3,(H,7,8).
What are the key properties of 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde?
2-methyl-1,4-dihydropyrimidine-5-carbaldehyde has a molecular weight of 124.14 g/mol, XLogP of 0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,4-dihydropyrimidine-5-carbaldehyde is sourced from PubChem (CID 123423409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).