C43H34N2Si — CID 123423561
N-phenyl-N-[4-[4-(2-triphenylsilylethenyl)phenyl]phenyl]pyridin-2-amine (PubChem CID 123423561) has the molecular formula C43H34N2Si and a molecular weight of 606.85 g/mol. Its IUPAC name is N-phenyl-N-[4-[4-(2-triphenylsilylethenyl)phenyl]phenyl]pyridin-2-amine.
| Compound Name | N-phenyl-N-[4-[4-(2-triphenylsilylethenyl)phenyl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 123423561 |
| Molecular Formula | C43H34N2Si |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | N-phenyl-N-[4-[4-(2-triphenylsilylethenyl)phenyl]phenyl]pyridin-2-amine |
| SMILES | C(=C[Si](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(-c2ccc(N(c3ccccc3)c3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C43H34N2Si/c1-5-15-38(16-6-1)45(43-23-13-14-33-44-43)39-30-28-37(29-31-39)36-26-24-35(25-27-36)32-34-46(40-17-7-2-8-18-40,41-19-9-3-10-20-41)42-21-11-4-12-22-42/h1-34H |
| InChIKey | MFSLDWWJHDSWQS-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|