About N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine
N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine (PubChem CID 123423742) has the molecular formula C12H26FNS
and a molecular weight of 235.41 g/mol. Its IUPAC name is N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine.
Molecular Properties
| Compound Name | N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine |
| PubChem CID | 123423742 |
| Molecular Formula | C12H26FNS |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine |
| SMILES | C=S(C)C(CCC)CCC(C)NCCF |
| InChI | InChI=1S/C12H26FNS/c1-5-6-12(15(3)4)8-7-11(2)14-10-9-13/h11-12,14H,3,5-10H2,1-2,4H3 |
| InChIKey | FAWMFBVVBOPMTP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine?
The IUPAC name of N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine (CID 123423742) is N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine.
What is the SMILES notation for N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine?
The canonical SMILES for N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine is C=S(C)C(CCC)CCC(C)NCCF.
What is the InChIKey of N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine?
The InChIKey is FAWMFBVVBOPMTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26FNS/c1-5-6-12(15(3)4)8-7-11(2)14-10-9-13/h11-12,14H,3,5-10H2,1-2,4H3.
What are the key properties of N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine?
N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine has a molecular weight of 235.41 g/mol, XLogP of 3.21, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoroethyl)-5-[methyl(methylidene)-λ4-sulfanyl]octan-2-amine is sourced from PubChem (CID 123423742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).