C17H23NO — CID 123424498
7,8-bis(ethenyl)-1-hexa-2,4-dien-3-yl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridine (PubChem CID 123424498) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 7,8-bis(ethenyl)-1-hexa-2,4-dien-3-yl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridine.
| Compound Name | 7,8-bis(ethenyl)-1-hexa-2,4-dien-3-yl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridine |
|---|---|
| PubChem CID | 123424498 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 7,8-bis(ethenyl)-1-hexa-2,4-dien-3-yl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyridine |
| SMILES | C=CC1=C(C=C)C2C(C(C=CC)=CC)OCN2CC1 |
| InChI | InChI=1S/C17H23NO/c1-5-9-14(7-3)17-16-15(8-4)13(6-2)10-11-18(16)12-19-17/h5-9,16-17H,2,4,10-12H2,1,3H3 |
| InChIKey | GGQJADPGMCJKEO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|