About propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate
propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 123424516) has the molecular formula C13H13ClFNO3
and a molecular weight of 285.70 g/mol. Its IUPAC name is propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| PubChem CID | 123424516 |
| Molecular Formula | C13H13ClFNO3 |
| Molecular Weight | 285.70 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | CC(C)OC(=O)C1CC(c2cccc(Cl)c2F)=NO1 |
| InChI | InChI=1S/C13H13ClFNO3/c1-7(2)18-13(17)11-6-10(16-19-11)8-4-3-5-9(14)12(8)15/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | XBSZKQCZYMYQPV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.70 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The IUPAC name of propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate (CID 123424516) is propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
What is the SMILES notation for propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The canonical SMILES for propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate is CC(C)OC(=O)C1CC(c2cccc(Cl)c2F)=NO1.
What is the InChIKey of propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The InChIKey is XBSZKQCZYMYQPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClFNO3/c1-7(2)18-13(17)11-6-10(16-19-11)8-4-3-5-9(14)12(8)15/h3-5,7,11H,6H2,1-2H3.
What are the key properties of propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate has a molecular weight of 285.70 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 123424516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).