C22H22N2O7 — CID 123424569
(3'aR,6'S,6'aS,9'aS,9'bR)-6'a-hydroxy-6',9'a-dimethyl-3-(3-nitrophenyl)spiro[2H-1,2-oxazole-5,3'-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan]-2',9'-dione (PubChem CID 123424569) has the molecular formula C22H22N2O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is (3'aR,6'S,6'aS,9'aS,9'bR)-6'a-hydroxy-6',9'a-dimethyl-3-(3-nitrophenyl)spiro[2H-1,2-oxazole-5,3'-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan]-2',9'-dione.
| Compound Name | (3'aR,6'S,6'aS,9'aS,9'bR)-6'a-hydroxy-6',9'a-dimethyl-3-(3-nitrophenyl)spiro[2H-1,2-oxazole-5,3'-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan]-2',9'-dione |
|---|---|
| PubChem CID | 123424569 |
| Molecular Formula | C22H22N2O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (3'aR,6'S,6'aS,9'aS,9'bR)-6'a-hydroxy-6',9'a-dimethyl-3-(3-nitrophenyl)spiro[2H-1,2-oxazole-5,3'-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan]-2',9'-dione |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](OC(=O)C23C=C(c2cccc([N+](=O)[O-])c2)NO3)[C@]2(C)C(=O)C=C[C@@]12O |
| InChI | InChI=1S/C22H22N2O7/c1-12-6-7-15-18(20(2)17(25)8-9-22(12,20)27)30-19(26)21(15)11-16(23-31-21)13-4-3-5-14(10-13)24(28)29/h3-5,8-12,15,18,23,27H,6-7H2,1-2H3/t12-,15+,18+,20-,21?,22+/m0/s1 |
| InChIKey | BXOQMACNMMVODJ-ZWEBVKRWSA-N |
| XLogP | 2.06 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|