C28H41N5 — CID 123424812
3-(4-aminophenyl)-N-[4-(2,3-dimethyloctyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine (PubChem CID 123424812) has the molecular formula C28H41N5 and a molecular weight of 447.67 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-[4-(2,3-dimethyloctyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-(4-aminophenyl)-N-[4-(2,3-dimethyloctyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 123424812 |
| Molecular Formula | C28H41N5 |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.34 |
| IUPAC Name | 3-(4-aminophenyl)-N-[4-(2,3-dimethyloctyl)cyclohexyl]imidazo[1,2-b]pyridazin-6-amine |
| SMILES | CCCCCC(C)C(C)CC1CCC(Nc2ccc3ncc(-c4ccc(N)cc4)n3n2)CC1 |
| InChI | InChI=1S/C28H41N5/c1-4-5-6-7-20(2)21(3)18-22-8-14-25(15-9-22)31-27-16-17-28-30-19-26(33(28)32-27)23-10-12-24(29)13-11-23/h10-13,16-17,19-22,25H,4-9,14-15,18,29H2,1-3H3,(H,31,32) |
| InChIKey | NNRUOZHTDHJNOO-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|