C21H27NO2 — CID 123425094
(E,6E)-6-[(2E,6Z)-6-acetyl-10-propyl-4H-azecin-5-ylidene]-2-methylhex-4-en-3-one (PubChem CID 123425094) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (E,6E)-6-[(2E,6Z)-6-acetyl-10-propyl-4H-azecin-5-ylidene]-2-methylhex-4-en-3-one.
| Compound Name | (E,6E)-6-[(2E,6Z)-6-acetyl-10-propyl-4H-azecin-5-ylidene]-2-methylhex-4-en-3-one |
|---|---|
| PubChem CID | 123425094 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (E,6E)-6-[(2E,6Z)-6-acetyl-10-propyl-4H-azecin-5-ylidene]-2-methylhex-4-en-3-one |
| SMILES | CCC/C1=N/C=C/CC(=C\C=C\C(=O)C(C)C)/C(C(C)=O)=C/C=C1 |
| InChI | InChI=1S/C21H27NO2/c1-5-9-19-12-7-13-20(17(4)23)18(11-8-15-22-19)10-6-14-21(24)16(2)3/h6-8,10,12-16H,5,9,11H2,1-4H3/b12-7?,14-6+,15-8+,18-10+,20-13+,22-19- |
| InChIKey | ULSGTYHPFDQYNW-XBCUQAPZSA-N |
| XLogP | 4.92 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|