C9H11N2O+ — CID 123425281
1,2,6-trimethyl-[1,3]oxazolo[5,4-b]pyridin-1-ium (PubChem CID 123425281) has the molecular formula C9H11N2O+ and a molecular weight of 163.20 g/mol. Its IUPAC name is 1,2,6-trimethyl-[1,3]oxazolo[5,4-b]pyridin-1-ium.
| Compound Name | 1,2,6-trimethyl-[1,3]oxazolo[5,4-b]pyridin-1-ium |
|---|---|
| PubChem CID | 123425281 |
| Molecular Formula | C9H11N2O+ |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 1,2,6-trimethyl-[1,3]oxazolo[5,4-b]pyridin-1-ium |
| SMILES | Cc1cnc2oc(C)[n+](C)c2c1 |
| InChI | InChI=1S/C9H11N2O/c1-6-4-8-9(10-5-6)12-7(2)11(8)3/h4-5H,1-3H3/q+1 |
| InChIKey | IZUBOBNZCOZSLD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|