C17H11Cl2F3NO3S- — CID 123425348
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzenesulfinate (PubChem CID 123425348) has the molecular formula C17H11Cl2F3NO3S- and a molecular weight of 437.25 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzenesulfinate.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzenesulfinate |
|---|---|
| PubChem CID | 123425348 |
| Molecular Formula | C17H11Cl2F3NO3S- |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzenesulfinate |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1S(=O)[O-] |
| InChI | InChI=1S/C17H12Cl2F3NO3S/c1-9-4-10(2-3-15(9)27(24)25)14-8-16(26-23-14,17(20,21)22)11-5-12(18)7-13(19)6-11/h2-7H,8H2,1H3,(H,24,25)/p-1 |
| InChIKey | XQHQUZOODGWETG-UHFFFAOYSA-M |
| XLogP | 5.12 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|