About 1-N-prop-2-enylpentane-1,2,3-triimine
1-N-prop-2-enylpentane-1,2,3-triimine (PubChem CID 123425391) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-N-prop-2-enylpentane-1,2,3-triimine.
Molecular Properties
| Compound Name | 1-N-prop-2-enylpentane-1,2,3-triimine |
| PubChem CID | 123425391 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1-N-prop-2-enylpentane-1,2,3-triimine |
| SMILES | [H]/N=C(/C=N/CC=C)C(\CC)=N\[H] |
| InChI | InChI=1S/C8H13N3/c1-3-5-11-6-8(10)7(9)4-2/h3,6,9-10H,1,4-5H2,2H3/b9-7+,10-8-,11-6+ |
| InChIKey | YFEVRBDKFVFDAH-ZYEAKNLOSA-N |
| XLogP | 1.69 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N-prop-2-enylpentane-1,2,3-triimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-prop-2-enylpentane-1,2,3-triimine?
The IUPAC name of 1-N-prop-2-enylpentane-1,2,3-triimine (CID 123425391) is 1-N-prop-2-enylpentane-1,2,3-triimine.
What is the SMILES notation for 1-N-prop-2-enylpentane-1,2,3-triimine?
The canonical SMILES for 1-N-prop-2-enylpentane-1,2,3-triimine is [H]/N=C(/C=N/CC=C)C(\CC)=N\[H].
What is the InChIKey of 1-N-prop-2-enylpentane-1,2,3-triimine?
The InChIKey is YFEVRBDKFVFDAH-ZYEAKNLOSA-N. The full InChI is InChI=1S/C8H13N3/c1-3-5-11-6-8(10)7(9)4-2/h3,6,9-10H,1,4-5H2,2H3/b9-7+,10-8-,11-6+.
What are the key properties of 1-N-prop-2-enylpentane-1,2,3-triimine?
1-N-prop-2-enylpentane-1,2,3-triimine has a molecular weight of 151.21 g/mol, XLogP of 1.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-prop-2-enylpentane-1,2,3-triimine is sourced from PubChem (CID 123425391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).