C9H23N3Si — CID 123425668
1-ethenylsilyl-N,N,N',N',N",N"-hexamethylmethanetriamine (PubChem CID 123425668) has the molecular formula C9H23N3Si and a molecular weight of 201.39 g/mol. Its IUPAC name is 1-ethenylsilyl-N,N,N',N',N",N"-hexamethylmethanetriamine.
| Compound Name | 1-ethenylsilyl-N,N,N',N',N",N"-hexamethylmethanetriamine |
|---|---|
| PubChem CID | 123425668 |
| Molecular Formula | C9H23N3Si |
| Molecular Weight | 201.39 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 1-ethenylsilyl-N,N,N',N',N",N"-hexamethylmethanetriamine |
| SMILES | C=C[SiH2]C(N(C)C)(N(C)C)N(C)C |
| InChI | InChI=1S/C9H23N3Si/c1-8-13-9(10(2)3,11(4)5)12(6)7/h8H,1,13H2,2-7H3 |
| InChIKey | UGNKOJZHWBTDJK-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.39 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|