C36H44N2O2 — CID 123426191
9-(4-methoxyphenyl)-6-[4-(2,4,5-trimethylheptan-2-yl)phenyl]-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 123426191) has the molecular formula C36H44N2O2 and a molecular weight of 536.76 g/mol. Its IUPAC name is 9-(4-methoxyphenyl)-6-[4-(2,4,5-trimethylheptan-2-yl)phenyl]-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(4-methoxyphenyl)-6-[4-(2,4,5-trimethylheptan-2-yl)phenyl]-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 123426191 |
| Molecular Formula | C36H44N2O2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | 9-(4-methoxyphenyl)-6-[4-(2,4,5-trimethylheptan-2-yl)phenyl]-5,6,6a,8,9,10-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCC(C)C(C)CC(C)(C)c1ccc(C2Nc3ccccc3N=C3CC(c4ccc(OC)cc4)CC(=O)C32)cc1 |
| InChI | InChI=1S/C36H44N2O2/c1-7-23(2)24(3)22-36(4,5)28-16-12-26(13-17-28)35-34-32(37-30-10-8-9-11-31(30)38-35)20-27(21-33(34)39)25-14-18-29(40-6)19-15-25/h8-19,23-24,27,34-35,38H,7,20-22H2,1-6H3 |
| InChIKey | NJLATJMUKZZSHJ-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |