About N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide
N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide (PubChem CID 123426202) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide.
Molecular Properties
| Compound Name | N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide |
| PubChem CID | 123426202 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide |
| SMILES | CCCCC(C)CC(C)=CC(=O)NCC1COCO1 |
| InChI | InChI=1S/C15H27NO3/c1-4-5-6-12(2)7-13(3)8-15(17)16-9-14-10-18-11-19-14/h8,12,14H,4-7,9-11H2,1-3H3,(H,16,17) |
| InChIKey | BSQDKMCVCDRFCJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide?
The IUPAC name of N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide (CID 123426202) is N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide.
What is the SMILES notation for N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide?
The canonical SMILES for N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide is CCCCC(C)CC(C)=CC(=O)NCC1COCO1.
What is the InChIKey of N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide?
The InChIKey is BSQDKMCVCDRFCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-4-5-6-12(2)7-13(3)8-15(17)16-9-14-10-18-11-19-14/h8,12,14H,4-7,9-11H2,1-3H3,(H,16,17).
What are the key properties of N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide?
N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide has a molecular weight of 269.38 g/mol, XLogP of 2.64, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dioxolan-4-ylmethyl)-3,5-dimethylnon-2-enamide is sourced from PubChem (CID 123426202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).