About 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine
1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine (PubChem CID 123426645) has the molecular formula C18H27F6NOSi
and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine |
| PubChem CID | 123426645 |
| Molecular Formula | C18H27F6NOSi |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(N)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H27F6NOSi/c1-16(2,3)27(4,5)26-7-6-15(25)10-12-8-13(17(19,20)21)11-14(9-12)18(22,23)24/h8-9,11,15H,6-7,10,25H2,1-5H3 |
| InChIKey | OMQBCAJNDQLBJR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine (CID 123426645) is 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine is CC(C)(C)[Si](C)(C)OCCC(N)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine?
The InChIKey is OMQBCAJNDQLBJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27F6NOSi/c1-16(2,3)27(4,5)26-7-6-15(25)10-12-8-13(17(19,20)21)11-14(9-12)18(22,23)24/h8-9,11,15H,6-7,10,25H2,1-5H3.
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine?
1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine has a molecular weight of 415.49 g/mol, XLogP of 6.01, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-4-[tert-butyl(dimethyl)silyl]oxybutan-2-amine is sourced from PubChem (CID 123426645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).