About dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium
dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium (PubChem CID 123427394) has the molecular formula C14H27N2+
and a molecular weight of 223.38 g/mol. Its IUPAC name is dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium.
Molecular Properties
| Compound Name | dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium |
| PubChem CID | 123427394 |
| Molecular Formula | C14H27N2+ |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.22 |
| IUPAC Name | dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium |
| SMILES | CCCC(=CC=[N+](C)C)C(NC)=C(C)CC |
| InChI | InChI=1S/C14H27N2/c1-7-9-13(10-11-16(5)6)14(15-4)12(3)8-2/h10-11,15H,7-9H2,1-6H3/q+1 |
| InChIKey | WRUVHXPJBHNFMI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium?
The IUPAC name of dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium (CID 123427394) is dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium.
What is the SMILES notation for dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium?
The canonical SMILES for dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium is CCCC(=CC=[N+](C)C)C(NC)=C(C)CC.
What is the InChIKey of dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium?
The InChIKey is WRUVHXPJBHNFMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N2/c1-7-9-13(10-11-16(5)6)14(15-4)12(3)8-2/h10-11,15H,7-9H2,1-6H3/q+1.
What are the key properties of dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium?
dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium has a molecular weight of 223.38 g/mol, XLogP of 2.96, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[5-methyl-4-(methylamino)-3-propylhepta-2,4-dienylidene]azanium is sourced from PubChem (CID 123427394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).