About CID 123427442
CID 123427442 (PubChem CID 123427442) has the molecular formula C12H18BN
and a molecular weight of 187.09 g/mol.
Molecular Properties
| Compound Name | CID 123427442 |
| PubChem CID | 123427442 |
| Molecular Formula | C12H18BN |
| Molecular Weight | 187.09 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C12H18BN/c1-12(2,3)9-14(4)11-7-5-10(13)6-8-11/h5-8H,9H2,1-4H3 |
| InChIKey | JMSKWEBGBAKTBU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.09 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123427442 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123427442?
The IUPAC name of CID 123427442 (CID 123427442) is not available.
What is the SMILES notation for CID 123427442?
The canonical SMILES for CID 123427442 is [B]c1ccc(N(C)CC(C)(C)C)cc1.
What is the InChIKey of CID 123427442?
The InChIKey is JMSKWEBGBAKTBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18BN/c1-12(2,3)9-14(4)11-7-5-10(13)6-8-11/h5-8H,9H2,1-4H3.
What are the key properties of CID 123427442?
CID 123427442 has a molecular weight of 187.09 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123427442 is sourced from PubChem (CID 123427442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).