C23H20F3N5O5 — CID 123427687
N'-hydroxy-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]pyrimidine-5-carboximidamide (PubChem CID 123427687) has the molecular formula C23H20F3N5O5 and a molecular weight of 503.44 g/mol. Its IUPAC name is N'-hydroxy-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]pyrimidine-5-carboximidamide.
| Compound Name | N'-hydroxy-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]pyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 123427687 |
| Molecular Formula | C23H20F3N5O5 |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N'-hydroxy-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]pyrimidine-5-carboximidamide |
| SMILES | Cc1c(Cn2c(=O)c(C(N)=NO)cn(-c3ccc(N4CCOC4=O)cc3)c2=O)cccc1C(F)(F)F |
| InChI | InChI=1S/C23H20F3N5O5/c1-13-14(3-2-4-18(13)23(24,25)26)11-31-20(32)17(19(27)28-35)12-30(21(31)33)16-7-5-15(6-8-16)29-9-10-36-22(29)34/h2-8,12,35H,9-11H2,1H3,(H2,27,28) |
| InChIKey | BBFTYBMRDXOCAU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|