C11H15F4N — CID 123428093
5-fluoro-1,3-dimethyl-7-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydroindole (PubChem CID 123428093) has the molecular formula C11H15F4N and a molecular weight of 237.24 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethyl-7-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydroindole.
| Compound Name | 5-fluoro-1,3-dimethyl-7-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 123428093 |
| Molecular Formula | C11H15F4N |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 5-fluoro-1,3-dimethyl-7-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydroindole |
| SMILES | CC1=CN(C)C2C1CC(F)CC2C(F)(F)F |
| InChI | InChI=1S/C11H15F4N/c1-6-5-16(2)10-8(6)3-7(12)4-9(10)11(13,14)15/h5,7-10H,3-4H2,1-2H3 |
| InChIKey | YKIWBLXWFAMKKC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |