C8H11N — CID 123428280
(3Z,5Z)-octa-3,5,7-trien-2-imine (PubChem CID 123428280) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is (3Z,5Z)-octa-3,5,7-trien-2-imine.
| Compound Name | (3Z,5Z)-octa-3,5,7-trien-2-imine |
|---|---|
| PubChem CID | 123428280 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | (3Z,5Z)-octa-3,5,7-trien-2-imine |
| SMILES | [H]/N=C(C)/C=C\C=C/C=C |
| InChI | InChI=1S/C8H11N/c1-3-4-5-6-7-8(2)9/h3-7,9H,1H2,2H3/b5-4-,7-6-,9-8+ |
| InChIKey | BEQOIZIDJSKXMO-JCBGPSFGSA-N |
| XLogP | 2.32 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|