C37H43N9O4 — CID 123429191
hexyl N-[amino-[4-[[5-[hydroxy-[[3-oxo-3-(pyridin-2-ylamino)propyl]-pyridin-2-ylamino]methyl]-1-methylbenzimidazol-2-yl]methylamino]phenyl]methylidene]carbamate (PubChem CID 123429191) has the molecular formula C37H43N9O4 and a molecular weight of 677.81 g/mol. Its IUPAC name is hexyl N-[amino-[4-[[5-[hydroxy-[[3-oxo-3-(pyridin-2-ylamino)propyl]-pyridin-2-ylamino]methyl]-1-methylbenzimidazol-2-yl]methylamino]phenyl]methylidene]carbamate.
| Compound Name | hexyl N-[amino-[4-[[5-[hydroxy-[[3-oxo-3-(pyridin-2-ylamino)propyl]-pyridin-2-ylamino]methyl]-1-methylbenzimidazol-2-yl]methylamino]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 123429191 |
| Molecular Formula | C37H43N9O4 |
| Molecular Weight | 677.81 g/mol |
| Exact Mass | 677.34 |
| IUPAC Name | hexyl N-[amino-[4-[[5-[hydroxy-[[3-oxo-3-(pyridin-2-ylamino)propyl]-pyridin-2-ylamino]methyl]-1-methylbenzimidazol-2-yl]methylamino]phenyl]methylidene]carbamate |
| SMILES | CCCCCCOC(=O)N=C(N)c1ccc(NCc2nc3cc(C(O)N(CCC(=O)Nc4ccccn4)c4ccccn4)ccc3n2C)cc1 |
| InChI | InChI=1S/C37H43N9O4/c1-3-4-5-10-23-50-37(49)44-35(38)26-13-16-28(17-14-26)41-25-33-42-29-24-27(15-18-30(29)45(33)2)36(48)46(32-12-7-9-21-40-32)22-19-34(47)43-31-11-6-8-20-39-31/h6-9,11-18,20-21,24,36,41,48H,3-5,10,19,22-23,25H2,1-2H3,(H2,38,44,49)(H,39,43,47) |
| InChIKey | DSWKXNIUJKOEGZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 172.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.81 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|