About 2,6-dimethoxy-3-methylhexa-1,3-diene
2,6-dimethoxy-3-methylhexa-1,3-diene (PubChem CID 123429220) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 2,6-dimethoxy-3-methylhexa-1,3-diene.
Molecular Properties
| Compound Name | 2,6-dimethoxy-3-methylhexa-1,3-diene |
| PubChem CID | 123429220 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 2,6-dimethoxy-3-methylhexa-1,3-diene |
| SMILES | C=C(OC)C(C)=CCCOC |
| InChI | InChI=1S/C9H16O2/c1-8(9(2)11-4)6-5-7-10-3/h6H,2,5,7H2,1,3-4H3 |
| InChIKey | KJJFODJECJCWTA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethoxy-3-methylhexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethoxy-3-methylhexa-1,3-diene?
The IUPAC name of 2,6-dimethoxy-3-methylhexa-1,3-diene (CID 123429220) is 2,6-dimethoxy-3-methylhexa-1,3-diene.
What is the SMILES notation for 2,6-dimethoxy-3-methylhexa-1,3-diene?
The canonical SMILES for 2,6-dimethoxy-3-methylhexa-1,3-diene is C=C(OC)C(C)=CCCOC.
What is the InChIKey of 2,6-dimethoxy-3-methylhexa-1,3-diene?
The InChIKey is KJJFODJECJCWTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-8(9(2)11-4)6-5-7-10-3/h6H,2,5,7H2,1,3-4H3.
What are the key properties of 2,6-dimethoxy-3-methylhexa-1,3-diene?
2,6-dimethoxy-3-methylhexa-1,3-diene has a molecular weight of 156.22 g/mol, XLogP of 2.13, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethoxy-3-methylhexa-1,3-diene is sourced from PubChem (CID 123429220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).