C26H28N4O3 — CID 123429752
N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methyl-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide (PubChem CID 123429752) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methyl-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide.
| Compound Name | N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methyl-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide |
|---|---|
| PubChem CID | 123429752 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[1-(3-cyano-4-propan-2-yloxyphenyl)ethenyl]-N'-methyl-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide |
| SMILES | C=C(N/C(=N\C)c1cccc2c1CCC2N1CCOC1=O)c1ccc(OC(C)C)c(C#N)c1 |
| InChI | InChI=1S/C26H28N4O3/c1-16(2)33-24-11-8-18(14-19(24)15-27)17(3)29-25(28-4)22-7-5-6-21-20(22)9-10-23(21)30-12-13-32-26(30)31/h5-8,11,14,16,23H,3,9-10,12-13H2,1-2,4H3,(H,28,29) |
| InChIKey | VPQMIYWFZUNPSA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|