C15H17F3N2OS — CID 123430112
N-[2-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 123430112) has the molecular formula C15H17F3N2OS and a molecular weight of 330.38 g/mol. Its IUPAC name is N-[2-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-[2-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 123430112 |
| Molecular Formula | C15H17F3N2OS |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[2-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CCCCCOc1c(Nc2nccs2)cccc1C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2OS/c1-2-3-4-9-21-13-11(15(16,17)18)6-5-7-12(13)20-14-19-8-10-22-14/h5-8,10H,2-4,9H2,1H3,(H,19,20) |
| InChIKey | HZWZAZUPCGZJFY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|