C19H34N6O8 — CID 123430413
2-[[4-amino-1-[2-[2-amino-3-(2,2,4,4-tetramethylpentanoyloxy)propanoyl]hydrazinyl]-1,4-dioxobutan-2-yl]carbamoylamino]acetic acid (PubChem CID 123430413) has the molecular formula C19H34N6O8 and a molecular weight of 474.52 g/mol. Its IUPAC name is 2-[[4-amino-1-[2-[2-amino-3-(2,2,4,4-tetramethylpentanoyloxy)propanoyl]hydrazinyl]-1,4-dioxobutan-2-yl]carbamoylamino]acetic acid.
| Compound Name | 2-[[4-amino-1-[2-[2-amino-3-(2,2,4,4-tetramethylpentanoyloxy)propanoyl]hydrazinyl]-1,4-dioxobutan-2-yl]carbamoylamino]acetic acid |
|---|---|
| PubChem CID | 123430413 |
| Molecular Formula | C19H34N6O8 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 2-[[4-amino-1-[2-[2-amino-3-(2,2,4,4-tetramethylpentanoyloxy)propanoyl]hydrazinyl]-1,4-dioxobutan-2-yl]carbamoylamino]acetic acid |
| SMILES | CC(C)(C)CC(C)(C)C(=O)OCC(N)C(=O)NNC(=O)C(CC(N)=O)NC(=O)NCC(=O)O |
| InChI | InChI=1S/C19H34N6O8/c1-18(2,3)9-19(4,5)16(31)33-8-10(20)14(29)24-25-15(30)11(6-12(21)26)23-17(32)22-7-13(27)28/h10-11H,6-9,20H2,1-5H3,(H2,21,26)(H,24,29)(H,25,30)(H,27,28)(H2,22,23,32) |
| InChIKey | FZRWBSRIZCPOJC-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 232.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|