C12H16BrN5O3 — CID 123430572
tert-butyl N-[amino-[(2-amino-5-bromopyridine-3-carbonyl)amino]methylidene]carbamate (PubChem CID 123430572) has the molecular formula C12H16BrN5O3 and a molecular weight of 358.20 g/mol. Its IUPAC name is tert-butyl N-[amino-[(2-amino-5-bromopyridine-3-carbonyl)amino]methylidene]carbamate.
| Compound Name | tert-butyl N-[amino-[(2-amino-5-bromopyridine-3-carbonyl)amino]methylidene]carbamate |
|---|---|
| PubChem CID | 123430572 |
| Molecular Formula | C12H16BrN5O3 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | tert-butyl N-[amino-[(2-amino-5-bromopyridine-3-carbonyl)amino]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(N)NC(=O)c1cc(Br)cnc1N |
| InChI | InChI=1S/C12H16BrN5O3/c1-12(2,3)21-11(20)18-10(15)17-9(19)7-4-6(13)5-16-8(7)14/h4-5H,1-3H3,(H2,14,16)(H3,15,17,18,19,20) |
| InChIKey | HARXQRKQDVKRBX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|