C18H22N2 — CID 123430879
(3-methylcyclohepta-1,3,6-trien-1-yl)-(6-propylcyclohepta-1,4,6-trien-1-yl)diazene (PubChem CID 123430879) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is (3-methylcyclohepta-1,3,6-trien-1-yl)-(6-propylcyclohepta-1,4,6-trien-1-yl)diazene.
| Compound Name | (3-methylcyclohepta-1,3,6-trien-1-yl)-(6-propylcyclohepta-1,4,6-trien-1-yl)diazene |
|---|---|
| PubChem CID | 123430879 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | (3-methylcyclohepta-1,3,6-trien-1-yl)-(6-propylcyclohepta-1,4,6-trien-1-yl)diazene |
| SMILES | CCCC1=CC(/N=N/C2=CC(C)=CCC=C2)=CCC=C1 |
| InChI | InChI=1S/C18H22N2/c1-3-8-16-10-5-7-12-18(14-16)20-19-17-11-6-4-9-15(2)13-17/h5-6,9-14H,3-4,7-8H2,1-2H3/b20-19+ |
| InChIKey | WAQFTYHBUZPTRO-FMQUCBEESA-N |
| XLogP | 5.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|