C7H11N3O — CID 123431126
1,4,6,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-9-one (PubChem CID 123431126) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 1,4,6,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-9-one.
| Compound Name | 1,4,6,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 123431126 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 1,4,6,7,8,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
| SMILES | O=C1NCCN2CC=NCC12 |
| InChI | InChI=1S/C7H11N3O/c11-7-6-5-8-1-3-10(6)4-2-9-7/h1,6H,2-5H2,(H,9,11) |
| InChIKey | MQHWFIYJAAFUPW-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |