C17H19F3N4O — CID 123431293
2-methylimino-1-(2-methylpropanimidoyl)-5-[4-(trifluoromethoxy)phenyl]pyridin-3-amine (PubChem CID 123431293) has the molecular formula C17H19F3N4O and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-methylimino-1-(2-methylpropanimidoyl)-5-[4-(trifluoromethoxy)phenyl]pyridin-3-amine.
| Compound Name | 2-methylimino-1-(2-methylpropanimidoyl)-5-[4-(trifluoromethoxy)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 123431293 |
| Molecular Formula | C17H19F3N4O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-methylimino-1-(2-methylpropanimidoyl)-5-[4-(trifluoromethoxy)phenyl]pyridin-3-amine |
| SMILES | [H]/N=C(\C(C)C)n1cc(-c2ccc(OC(F)(F)F)cc2)cc(N)/c1=N\C |
| InChI | InChI=1S/C17H19F3N4O/c1-10(2)15(22)24-9-12(8-14(21)16(24)23-3)11-4-6-13(7-5-11)25-17(18,19)20/h4-10,22H,21H2,1-3H3/b22-15+,23-16+ |
| InChIKey | ZAFFFWMLZCAEQB-QAOSGDJLSA-N |
| XLogP | 3.65 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|