C24H21ClN2O6 — CID 123431684
(2S,4'S,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-phenylspiro[1-benzofuran-2,6'-4,4a,7,8-tetrahydro-3H-quinazoline]-2',3,5'-trione (PubChem CID 123431684) has the molecular formula C24H21ClN2O6 and a molecular weight of 468.89 g/mol. Its IUPAC name is (2S,4'S,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-phenylspiro[1-benzofuran-2,6'-4,4a,7,8-tetrahydro-3H-quinazoline]-2',3,5'-trione.
| Compound Name | (2S,4'S,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-phenylspiro[1-benzofuran-2,6'-4,4a,7,8-tetrahydro-3H-quinazoline]-2',3,5'-trione |
|---|---|
| PubChem CID | 123431684 |
| Molecular Formula | C24H21ClN2O6 |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | (2S,4'S,7'R)-7-chloro-4,6-dimethoxy-7'-methyl-4'-phenylspiro[1-benzofuran-2,6'-4,4a,7,8-tetrahydro-3H-quinazoline]-2',3,5'-trione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@]1(C2=O)C(=O)C2C(=NC(=O)N[C@@H]2c2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C24H21ClN2O6/c1-11-9-13-16(19(27-23(30)26-13)12-7-5-4-6-8-12)21(28)24(11)22(29)17-14(31-2)10-15(32-3)18(25)20(17)33-24/h4-8,10-11,16,19H,9H2,1-3H3,(H,27,30)/t11-,16?,19-,24+/m1/s1 |
| InChIKey | LCIKANIHANGNGJ-FEAPOWFXSA-N |
| XLogP | 3.80 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|