C31H32FN3O3 — CID 123432033
3-[4-(2-fluorobut-3-en-2-yloxy)phenyl]-1-[[3-(6-methoxyquinolin-3-yl)phenyl]methyl]-1-propan-2-ylurea (PubChem CID 123432033) has the molecular formula C31H32FN3O3 and a molecular weight of 513.61 g/mol. Its IUPAC name is 3-[4-(2-fluorobut-3-en-2-yloxy)phenyl]-1-[[3-(6-methoxyquinolin-3-yl)phenyl]methyl]-1-propan-2-ylurea.
| Compound Name | 3-[4-(2-fluorobut-3-en-2-yloxy)phenyl]-1-[[3-(6-methoxyquinolin-3-yl)phenyl]methyl]-1-propan-2-ylurea |
|---|---|
| PubChem CID | 123432033 |
| Molecular Formula | C31H32FN3O3 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 3-[4-(2-fluorobut-3-en-2-yloxy)phenyl]-1-[[3-(6-methoxyquinolin-3-yl)phenyl]methyl]-1-propan-2-ylurea |
| SMILES | C=CC(C)(F)Oc1ccc(NC(=O)N(Cc2cccc(-c3cnc4ccc(OC)cc4c3)c2)C(C)C)cc1 |
| InChI | InChI=1S/C31H32FN3O3/c1-6-31(4,32)38-27-12-10-26(11-13-27)34-30(36)35(21(2)3)20-22-8-7-9-23(16-22)25-17-24-18-28(37-5)14-15-29(24)33-19-25/h6-19,21H,1,20H2,2-5H3,(H,34,36) |
| InChIKey | WNZJYEGZKUTFHU-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|