C31H58O3Si2 — CID 123432072
(8R,9R,10R,13S,14S)-3,17-bis(2,3-dimethylbutan-2-ylsilyloxy)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one (PubChem CID 123432072) has the molecular formula C31H58O3Si2 and a molecular weight of 534.97 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-3,17-bis(2,3-dimethylbutan-2-ylsilyloxy)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one.
| Compound Name | (8R,9R,10R,13S,14S)-3,17-bis(2,3-dimethylbutan-2-ylsilyloxy)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 123432072 |
| Molecular Formula | C31H58O3Si2 |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 534.39 |
| IUPAC Name | (8R,9R,10R,13S,14S)-3,17-bis(2,3-dimethylbutan-2-ylsilyloxy)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
| SMILES | CC(C)C(C)(C)[SiH2]OC1CC[C@@]2(C)C(C1)C(=O)C[C@@H]1[C@H]2CC[C@]2(C)C(O[SiH2]C(C)(C)C(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C31H58O3Si2/c1-19(2)28(5,6)35-33-21-13-15-30(9)24-14-16-31(10)23(22(24)18-26(32)25(30)17-21)11-12-27(31)34-36-29(7,8)20(3)4/h19-25,27H,11-18,35-36H2,1-10H3/t21?,22-,23-,24+,25?,27?,30+,31-/m0/s1 |
| InChIKey | PXQZTAZDPKDCBY-IFDCRREZSA-N |
| XLogP | 6.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|