C12H17FO7 — CID 123432154
1-[(2R,3S,4S,5S)-4,5-diacetyl-3-fluoro-4,5-dihydroxyoxan-2-yl]-2-hydroxypropan-1-one (PubChem CID 123432154) has the molecular formula C12H17FO7 and a molecular weight of 292.26 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5S)-4,5-diacetyl-3-fluoro-4,5-dihydroxyoxan-2-yl]-2-hydroxypropan-1-one.
| Compound Name | 1-[(2R,3S,4S,5S)-4,5-diacetyl-3-fluoro-4,5-dihydroxyoxan-2-yl]-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 123432154 |
| Molecular Formula | C12H17FO7 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-[(2R,3S,4S,5S)-4,5-diacetyl-3-fluoro-4,5-dihydroxyoxan-2-yl]-2-hydroxypropan-1-one |
| SMILES | CC(=O)[C@]1(O)CO[C@H](C(=O)C(C)O)[C@H](F)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C12H17FO7/c1-5(14)8(17)9-10(13)12(19,7(3)16)11(18,4-20-9)6(2)15/h5,9-10,14,18-19H,4H2,1-3H3/t5?,9-,10+,11-,12+/m1/s1 |
| InChIKey | FYAMYFUPPDCHBL-GEMLDJCESA-N |
| XLogP | -1.69 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |