About 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol
1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol (PubChem CID 123432172) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol.
Molecular Properties
| Compound Name | 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol |
| PubChem CID | 123432172 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol |
| SMILES | CNc1ncc(-c2cccc(C3(O)CC3)c2)o1 |
| InChI | InChI=1S/C13H14N2O2/c1-14-12-15-8-11(17-12)9-3-2-4-10(7-9)13(16)5-6-13/h2-4,7-8,16H,5-6H2,1H3,(H,14,15) |
| InChIKey | TZGMTOLHSPMQBX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol?
The IUPAC name of 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol (CID 123432172) is 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol.
What is the SMILES notation for 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol?
The canonical SMILES for 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol is CNc1ncc(-c2cccc(C3(O)CC3)c2)o1.
What is the InChIKey of 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol?
The InChIKey is TZGMTOLHSPMQBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-14-12-15-8-11(17-12)9-3-2-4-10(7-9)13(16)5-6-13/h2-4,7-8,16H,5-6H2,1H3,(H,14,15).
What are the key properties of 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol?
1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol has a molecular weight of 230.27 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[2-(methylamino)-1,3-oxazol-5-yl]phenyl]cyclopropan-1-ol is sourced from PubChem (CID 123432172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).