C16H29ClN2S — CID 123432382
N'-[1-(4-ethyl-6-ethylidenenon-1-en-2-yl)sulfanylethyl]carbamimidoyl chloride (PubChem CID 123432382) has the molecular formula C16H29ClN2S and a molecular weight of 316.94 g/mol. Its IUPAC name is N'-[1-(4-ethyl-6-ethylidenenon-1-en-2-yl)sulfanylethyl]carbamimidoyl chloride.
| Compound Name | N'-[1-(4-ethyl-6-ethylidenenon-1-en-2-yl)sulfanylethyl]carbamimidoyl chloride |
|---|---|
| PubChem CID | 123432382 |
| Molecular Formula | C16H29ClN2S |
| Molecular Weight | 316.94 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N'-[1-(4-ethyl-6-ethylidenenon-1-en-2-yl)sulfanylethyl]carbamimidoyl chloride |
| SMILES | C=C(CC(CC)CC(=CC)CCC)SC(C)N=C(N)Cl |
| InChI | InChI=1S/C16H29ClN2S/c1-6-9-14(7-2)11-15(8-3)10-12(4)20-13(5)19-16(17)18/h7,13,15H,4,6,8-11H2,1-3,5H3,(H2,18,19) |
| InChIKey | JGILKRIQZPOLBE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.94 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|