About 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one
1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one (PubChem CID 123432520) has the molecular formula C5H5N4O+
and a molecular weight of 137.12 g/mol. Its IUPAC name is 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one.
Molecular Properties
| Compound Name | 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one |
| PubChem CID | 123432520 |
| Molecular Formula | C5H5N4O+ |
| Molecular Weight | 137.12 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one |
| SMILES | O=c1[nH]ncc2c[nH+][nH]c12 |
| InChI | InChI=1S/C5H4N4O/c10-5-4-3(1-6-8-4)2-7-9-5/h1-2H,(H,6,8)(H,9,10)/p+1 |
| InChIKey | QICFIUZWDPJRQF-UHFFFAOYSA-O |
| XLogP | -0.93 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.12 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one?
The IUPAC name of 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one (CID 123432520) is 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one.
What is the SMILES notation for 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one?
The canonical SMILES for 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one is O=c1[nH]ncc2c[nH+][nH]c12.
What is the InChIKey of 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one?
The InChIKey is QICFIUZWDPJRQF-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H4N4O/c10-5-4-3(1-6-8-4)2-7-9-5/h1-2H,(H,6,8)(H,9,10)/p+1.
What are the key properties of 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one?
1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one has a molecular weight of 137.12 g/mol, XLogP of -0.93, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydropyrazolo[4,5-d]pyridazin-2-ium-7-one is sourced from PubChem (CID 123432520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).