About 8-methyl-4-propylthieno[2,3-f][1]benzothiole
8-methyl-4-propylthieno[2,3-f][1]benzothiole (PubChem CID 123432541) has the molecular formula C14H14S2
and a molecular weight of 246.40 g/mol. Its IUPAC name is 8-methyl-4-propylthieno[2,3-f][1]benzothiole.
Molecular Properties
| Compound Name | 8-methyl-4-propylthieno[2,3-f][1]benzothiole |
| PubChem CID | 123432541 |
| Molecular Formula | C14H14S2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 8-methyl-4-propylthieno[2,3-f][1]benzothiole |
| SMILES | CCCc1c2ccsc2c(C)c2ccsc12 |
| InChI | InChI=1S/C14H14S2/c1-3-4-11-12-6-8-15-13(12)9(2)10-5-7-16-14(10)11/h5-8H,3-4H2,1-2H3 |
| InChIKey | RMVBHMOZMNOACX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-4-propylthieno[2,3-f][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4-propylthieno[2,3-f][1]benzothiole?
The IUPAC name of 8-methyl-4-propylthieno[2,3-f][1]benzothiole (CID 123432541) is 8-methyl-4-propylthieno[2,3-f][1]benzothiole.
What is the SMILES notation for 8-methyl-4-propylthieno[2,3-f][1]benzothiole?
The canonical SMILES for 8-methyl-4-propylthieno[2,3-f][1]benzothiole is CCCc1c2ccsc2c(C)c2ccsc12.
What is the InChIKey of 8-methyl-4-propylthieno[2,3-f][1]benzothiole?
The InChIKey is RMVBHMOZMNOACX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14S2/c1-3-4-11-12-6-8-15-13(12)9(2)10-5-7-16-14(10)11/h5-8H,3-4H2,1-2H3.
What are the key properties of 8-methyl-4-propylthieno[2,3-f][1]benzothiole?
8-methyl-4-propylthieno[2,3-f][1]benzothiole has a molecular weight of 246.40 g/mol, XLogP of 5.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4-propylthieno[2,3-f][1]benzothiole is sourced from PubChem (CID 123432541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).