C33H60O6 — CID 123432558
4-[[6-[[2,2-dimethyl-6-(3,3,5,5-tetramethylheptyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-6-ethenyl-2,2-dimethyl-1,3-dioxane (PubChem CID 123432558) has the molecular formula C33H60O6 and a molecular weight of 552.84 g/mol. Its IUPAC name is 4-[[6-[[2,2-dimethyl-6-(3,3,5,5-tetramethylheptyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-6-ethenyl-2,2-dimethyl-1,3-dioxane.
| Compound Name | 4-[[6-[[2,2-dimethyl-6-(3,3,5,5-tetramethylheptyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-6-ethenyl-2,2-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 123432558 |
| Molecular Formula | C33H60O6 |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 552.44 |
| IUPAC Name | 4-[[6-[[2,2-dimethyl-6-(3,3,5,5-tetramethylheptyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-6-ethenyl-2,2-dimethyl-1,3-dioxane |
| SMILES | C=CC1CC(CC2CC(CC3CC(CCC(C)(C)CC(C)(C)CC)OC(C)(C)O3)OC(C)(C)O2)OC(C)(C)O1 |
| InChI | InChI=1S/C33H60O6/c1-13-23-17-25(36-31(7,8)34-23)19-27-21-28(39-33(11,12)38-27)20-26-18-24(35-32(9,10)37-26)15-16-30(5,6)22-29(3,4)14-2/h13,23-28H,1,14-22H2,2-12H3 |
| InChIKey | GKZBZVQGQDZSSU-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|