About 1H-pyridazino[1,2-a]indazole
1H-pyridazino[1,2-a]indazole (PubChem CID 123432705) has the molecular formula C11H10N2
and a molecular weight of 170.22 g/mol. Its IUPAC name is 1H-pyridazino[1,2-a]indazole.
Molecular Properties
| Compound Name | 1H-pyridazino[1,2-a]indazole |
| PubChem CID | 123432705 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1H-pyridazino[1,2-a]indazole |
| SMILES | C1=CCC2=CN3C=CC=CN3C2=C1 |
| InChI | InChI=1S/C11H10N2/c1-2-6-11-10(5-1)9-12-7-3-4-8-13(11)12/h1-4,6-9H,5H2 |
| InChIKey | RVGNATOUOLOXOB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyridazino[1,2-a]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyridazino[1,2-a]indazole?
The IUPAC name of 1H-pyridazino[1,2-a]indazole (CID 123432705) is 1H-pyridazino[1,2-a]indazole.
What is the SMILES notation for 1H-pyridazino[1,2-a]indazole?
The canonical SMILES for 1H-pyridazino[1,2-a]indazole is C1=CCC2=CN3C=CC=CN3C2=C1.
What is the InChIKey of 1H-pyridazino[1,2-a]indazole?
The InChIKey is RVGNATOUOLOXOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c1-2-6-11-10(5-1)9-12-7-3-4-8-13(11)12/h1-4,6-9H,5H2.
What are the key properties of 1H-pyridazino[1,2-a]indazole?
1H-pyridazino[1,2-a]indazole has a molecular weight of 170.22 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyridazino[1,2-a]indazole is sourced from PubChem (CID 123432705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).